C24H20N2O3S — CID 7842327
[2-(2-ethylanilino)-2-oxoethyl] 2-(1,3-benzothiazol-2-yl)benzoate (PubChem CID 7842327) has the molecular formula C24H20N2O3S and a molecular weight of 416.50 g/mol. Its IUPAC name is [2-(2-ethylanilino)-2-oxoethyl] 2-(1,3-benzothiazol-2-yl)benzoate.
| Compound Name | [2-(2-ethylanilino)-2-oxoethyl] 2-(1,3-benzothiazol-2-yl)benzoate |
|---|---|
| PubChem CID | 7842327 |
| Molecular Formula | C24H20N2O3S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | [2-(2-ethylanilino)-2-oxoethyl] 2-(1,3-benzothiazol-2-yl)benzoate |
| SMILES | CCc1ccccc1NC(=O)COC(=O)c1ccccc1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C24H20N2O3S/c1-2-16-9-3-6-12-19(16)25-22(27)15-29-24(28)18-11-5-4-10-17(18)23-26-20-13-7-8-14-21(20)30-23/h3-14H,2,15H2,1H3,(H,25,27) |
| InChIKey | AGCXEGAAJYOMIV-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |