C28H20N2O4S — CID 3521063
[2-oxo-2-(2-phenoxyanilino)ethyl] 2-(1,3-benzothiazol-2-yl)benzoate (PubChem CID 3521063) has the molecular formula C28H20N2O4S and a molecular weight of 480.55 g/mol. Its IUPAC name is [2-oxo-2-(2-phenoxyanilino)ethyl] 2-(1,3-benzothiazol-2-yl)benzoate.
| Compound Name | [2-oxo-2-(2-phenoxyanilino)ethyl] 2-(1,3-benzothiazol-2-yl)benzoate |
|---|---|
| PubChem CID | 3521063 |
| Molecular Formula | C28H20N2O4S |
| Molecular Weight | 480.55 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | [2-oxo-2-(2-phenoxyanilino)ethyl] 2-(1,3-benzothiazol-2-yl)benzoate |
| SMILES | O=C(COC(=O)c1ccccc1-c1nc2ccccc2s1)Nc1ccccc1Oc1ccccc1 |
| InChI | InChI=1S/C28H20N2O4S/c31-26(29-22-14-6-8-16-24(22)34-19-10-2-1-3-11-19)18-33-28(32)21-13-5-4-12-20(21)27-30-23-15-7-9-17-25(23)35-27/h1-17H,18H2,(H,29,31) |
| InChIKey | YPMSOPHTRZNXFY-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.55 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |