C17H13NO3S — CID 2581641
2-oxopropyl 2-(1,3-benzothiazol-2-yl)benzoate (PubChem CID 2581641) has the molecular formula C17H13NO3S and a molecular weight of 311.36 g/mol. Its IUPAC name is 2-oxopropyl 2-(1,3-benzothiazol-2-yl)benzoate.
| Compound Name | 2-oxopropyl 2-(1,3-benzothiazol-2-yl)benzoate |
|---|---|
| PubChem CID | 2581641 |
| Molecular Formula | C17H13NO3S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | 2-oxopropyl 2-(1,3-benzothiazol-2-yl)benzoate |
| SMILES | CC(=O)COC(=O)c1ccccc1-c1nc2ccccc2s1 |
| InChI | InChI=1S/C17H13NO3S/c1-11(19)10-21-17(20)13-7-3-2-6-12(13)16-18-14-8-4-5-9-15(14)22-16/h2-9H,10H2,1H3 |
| InChIKey | LKULZXXUQJQNPK-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |