C27H24N2O5S — CID 2581542
[2-(4-butoxycarbonylanilino)-2-oxoethyl] 2-(1,3-benzothiazol-2-yl)benzoate (PubChem CID 2581542) has the molecular formula C27H24N2O5S and a molecular weight of 488.57 g/mol. Its IUPAC name is [2-(4-butoxycarbonylanilino)-2-oxoethyl] 2-(1,3-benzothiazol-2-yl)benzoate.
| Compound Name | [2-(4-butoxycarbonylanilino)-2-oxoethyl] 2-(1,3-benzothiazol-2-yl)benzoate |
|---|---|
| PubChem CID | 2581542 |
| Molecular Formula | C27H24N2O5S |
| Molecular Weight | 488.57 g/mol |
| Exact Mass | 488.14 |
| IUPAC Name | [2-(4-butoxycarbonylanilino)-2-oxoethyl] 2-(1,3-benzothiazol-2-yl)benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)COC(=O)c2ccccc2-c2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C27H24N2O5S/c1-2-3-16-33-26(31)18-12-14-19(15-13-18)28-24(30)17-34-27(32)21-9-5-4-8-20(21)25-29-22-10-6-7-11-23(22)35-25/h4-15H,2-3,16-17H2,1H3,(H,28,30) |
| InChIKey | NBMWXETUORQMCA-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 94.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.57 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|