C21H22N2O3S2 — CID 39757179
pentyl 4-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]amino]benzoate (PubChem CID 39757179) has the molecular formula C21H22N2O3S2 and a molecular weight of 414.55 g/mol. Its IUPAC name is pentyl 4-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]amino]benzoate.
| Compound Name | pentyl 4-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]amino]benzoate |
|---|---|
| PubChem CID | 39757179 |
| Molecular Formula | C21H22N2O3S2 |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | pentyl 4-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]amino]benzoate |
| SMILES | CCCCCOC(=O)c1ccc(NC(=O)CSc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C21H22N2O3S2/c1-2-3-6-13-26-20(25)15-9-11-16(12-10-15)22-19(24)14-27-21-23-17-7-4-5-8-18(17)28-21/h4-5,7-12H,2-3,6,13-14H2,1H3,(H,22,24) |
| InChIKey | CZQXPOLYZDICJI-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|