C32H37N3O3S2 — CID 5160727
N-[2-(2-anilino-2-oxoethyl)sulfanyl-1,3-benzothiazol-6-yl]-4-decoxybenzamide (PubChem CID 5160727) has the molecular formula C32H37N3O3S2 and a molecular weight of 575.80 g/mol. Its IUPAC name is N-[2-(2-anilino-2-oxoethyl)sulfanyl-1,3-benzothiazol-6-yl]-4-decoxybenzamide.
| Compound Name | N-[2-(2-anilino-2-oxoethyl)sulfanyl-1,3-benzothiazol-6-yl]-4-decoxybenzamide |
|---|---|
| PubChem CID | 5160727 |
| Molecular Formula | C32H37N3O3S2 |
| Molecular Weight | 575.80 g/mol |
| Exact Mass | 575.23 |
| IUPAC Name | N-[2-(2-anilino-2-oxoethyl)sulfanyl-1,3-benzothiazol-6-yl]-4-decoxybenzamide |
| SMILES | CCCCCCCCCCOc1ccc(C(=O)Nc2ccc3nc(SCC(=O)Nc4ccccc4)sc3c2)cc1 |
| InChI | InChI=1S/C32H37N3O3S2/c1-2-3-4-5-6-7-8-12-21-38-27-18-15-24(16-19-27)31(37)34-26-17-20-28-29(22-26)40-32(35-28)39-23-30(36)33-25-13-10-9-11-14-25/h9-11,13-20,22H,2-8,12,21,23H2,1H3,(H,33,36)(H,34,37) |
| InChIKey | MXHIPUBMQNYEMD-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.80 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|