C35H43N3O3S2 — CID 124529326
4-decoxy-N-[2-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]sulfanyl-1,3-benzothiazol-6-yl]benzamide (PubChem CID 124529326) has the molecular formula C35H43N3O3S2 and a molecular weight of 617.88 g/mol. Its IUPAC name is 4-decoxy-N-[2-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]sulfanyl-1,3-benzothiazol-6-yl]benzamide.
| Compound Name | 4-decoxy-N-[2-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]sulfanyl-1,3-benzothiazol-6-yl]benzamide |
|---|---|
| PubChem CID | 124529326 |
| Molecular Formula | C35H43N3O3S2 |
| Molecular Weight | 617.88 g/mol |
| Exact Mass | 617.27 |
| IUPAC Name | 4-decoxy-N-[2-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]sulfanyl-1,3-benzothiazol-6-yl]benzamide |
| SMILES | CCCCCCCCCCOc1ccc(C(=O)Nc2ccc3nc(SCC(=O)Nc4c(C)cc(C)cc4C)sc3c2)cc1 |
| InChI | InChI=1S/C35H43N3O3S2/c1-5-6-7-8-9-10-11-12-19-41-29-16-13-27(14-17-29)34(40)36-28-15-18-30-31(22-28)43-35(37-30)42-23-32(39)38-33-25(3)20-24(2)21-26(33)4/h13-18,20-22H,5-12,19,23H2,1-4H3,(H,36,40)(H,38,39) |
| InChIKey | RTBNBIQNZRTBFK-UHFFFAOYSA-N |
| XLogP | 9.72 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.88 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|