C33H36N6O3S3 — CID 124598405
2-[[5-[(4-tert-butylphenoxy)methyl]-1H-1,2,4-triazol-3-yl]sulfanyl]-N-[2-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]sulfanyl-1,3-benzothiazol-6-yl]acetamide (PubChem CID 124598405) has the molecular formula C33H36N6O3S3 and a molecular weight of 660.89 g/mol. Its IUPAC name is 2-[[5-[(4-tert-butylphenoxy)methyl]-1H-1,2,4-triazol-3-yl]sulfanyl]-N-[2-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]sulfanyl-1,3-benzothiazol-6-yl]acetamide.
| Compound Name | 2-[[5-[(4-tert-butylphenoxy)methyl]-1H-1,2,4-triazol-3-yl]sulfanyl]-N-[2-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]sulfanyl-1,3-benzothiazol-6-yl]acetamide |
|---|---|
| PubChem CID | 124598405 |
| Molecular Formula | C33H36N6O3S3 |
| Molecular Weight | 660.89 g/mol |
| Exact Mass | 660.20 |
| IUPAC Name | 2-[[5-[(4-tert-butylphenoxy)methyl]-1H-1,2,4-triazol-3-yl]sulfanyl]-N-[2-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]sulfanyl-1,3-benzothiazol-6-yl]acetamide |
| SMILES | Cc1cc(C)c(NC(=O)CSc2nc3ccc(NC(=O)CSc4n[nH]c(COc5ccc(C(C)(C)C)cc5)n4)cc3s2)c(C)c1 |
| InChI | InChI=1S/C33H36N6O3S3/c1-19-13-20(2)30(21(3)14-19)37-29(41)18-44-32-35-25-12-9-23(15-26(25)45-32)34-28(40)17-43-31-36-27(38-39-31)16-42-24-10-7-22(8-11-24)33(4,5)6/h7-15H,16-18H2,1-6H3,(H,34,40)(H,37,41)(H,36,38,39) |
| InChIKey | FRSFPXJXFWONKU-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 121.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.89 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |