C23H23N5O2S4 — CID 3475710
2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[2-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]sulfanyl-1,3-benzothiazol-6-yl]acetamide (PubChem CID 3475710) has the molecular formula C23H23N5O2S4 and a molecular weight of 529.74 g/mol. Its IUPAC name is 2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[2-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]sulfanyl-1,3-benzothiazol-6-yl]acetamide.
| Compound Name | 2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[2-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]sulfanyl-1,3-benzothiazol-6-yl]acetamide |
|---|---|
| PubChem CID | 3475710 |
| Molecular Formula | C23H23N5O2S4 |
| Molecular Weight | 529.74 g/mol |
| Exact Mass | 529.07 |
| IUPAC Name | 2-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]-N-[2-[2-oxo-2-(2,4,6-trimethylanilino)ethyl]sulfanyl-1,3-benzothiazol-6-yl]acetamide |
| SMILES | Cc1cc(C)c(NC(=O)CSc2nc3ccc(NC(=O)CSc4nnc(C)s4)cc3s2)c(C)c1 |
| InChI | InChI=1S/C23H23N5O2S4/c1-12-7-13(2)21(14(3)8-12)26-20(30)11-31-22-25-17-6-5-16(9-18(17)34-22)24-19(29)10-32-23-28-27-15(4)33-23/h5-9H,10-11H2,1-4H3,(H,24,29)(H,26,30) |
| InChIKey | RODAQBYYYBCNLQ-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 96.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.74 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |