C32H36N4O5S2 — CID 124529600
4-decoxy-N-[2-[2-(2-nitroanilino)-2-oxoethyl]sulfanyl-1,3-benzothiazol-6-yl]benzamide (PubChem CID 124529600) has the molecular formula C32H36N4O5S2 and a molecular weight of 620.80 g/mol. Its IUPAC name is 4-decoxy-N-[2-[2-(2-nitroanilino)-2-oxoethyl]sulfanyl-1,3-benzothiazol-6-yl]benzamide.
| Compound Name | 4-decoxy-N-[2-[2-(2-nitroanilino)-2-oxoethyl]sulfanyl-1,3-benzothiazol-6-yl]benzamide |
|---|---|
| PubChem CID | 124529600 |
| Molecular Formula | C32H36N4O5S2 |
| Molecular Weight | 620.80 g/mol |
| Exact Mass | 620.21 |
| IUPAC Name | 4-decoxy-N-[2-[2-(2-nitroanilino)-2-oxoethyl]sulfanyl-1,3-benzothiazol-6-yl]benzamide |
| SMILES | CCCCCCCCCCOc1ccc(C(=O)Nc2ccc3nc(SCC(=O)Nc4ccccc4[N+](=O)[O-])sc3c2)cc1 |
| InChI | InChI=1S/C32H36N4O5S2/c1-2-3-4-5-6-7-8-11-20-41-25-17-14-23(15-18-25)31(38)33-24-16-19-27-29(21-24)43-32(35-27)42-22-30(37)34-26-12-9-10-13-28(26)36(39)40/h9-10,12-19,21H,2-8,11,20,22H2,1H3,(H,33,38)(H,34,37) |
| InChIKey | QPRQFDFQXSCYMC-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 123.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.80 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|