C28H20N4O4S2 — CID 23942168
4-nitro-N-[2-[2-oxo-2-(4-phenylanilino)ethyl]sulfanyl-1,3-benzothiazol-6-yl]benzamide (PubChem CID 23942168) has the molecular formula C28H20N4O4S2 and a molecular weight of 540.63 g/mol. Its IUPAC name is 4-nitro-N-[2-[2-oxo-2-(4-phenylanilino)ethyl]sulfanyl-1,3-benzothiazol-6-yl]benzamide.
| Compound Name | 4-nitro-N-[2-[2-oxo-2-(4-phenylanilino)ethyl]sulfanyl-1,3-benzothiazol-6-yl]benzamide |
|---|---|
| PubChem CID | 23942168 |
| Molecular Formula | C28H20N4O4S2 |
| Molecular Weight | 540.63 g/mol |
| Exact Mass | 540.09 |
| IUPAC Name | 4-nitro-N-[2-[2-oxo-2-(4-phenylanilino)ethyl]sulfanyl-1,3-benzothiazol-6-yl]benzamide |
| SMILES | O=C(CSc1nc2ccc(NC(=O)c3ccc([N+](=O)[O-])cc3)cc2s1)Nc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C28H20N4O4S2/c33-26(29-21-10-6-19(7-11-21)18-4-2-1-3-5-18)17-37-28-31-24-15-12-22(16-25(24)38-28)30-27(34)20-8-13-23(14-9-20)32(35)36/h1-16H,17H2,(H,29,33)(H,30,34) |
| InChIKey | XGEGUOGGZZNJDO-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 114.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.63 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|