C25H19N5O5S4 — CID 23819442
N-[2-[2-(2-methoxyanilino)-2-oxoethyl]sulfanyl-1,3-benzothiazol-6-yl]-2-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]acetamide (PubChem CID 23819442) has the molecular formula C25H19N5O5S4 and a molecular weight of 597.73 g/mol. Its IUPAC name is N-[2-[2-(2-methoxyanilino)-2-oxoethyl]sulfanyl-1,3-benzothiazol-6-yl]-2-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]acetamide.
| Compound Name | N-[2-[2-(2-methoxyanilino)-2-oxoethyl]sulfanyl-1,3-benzothiazol-6-yl]-2-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]acetamide |
|---|---|
| PubChem CID | 23819442 |
| Molecular Formula | C25H19N5O5S4 |
| Molecular Weight | 597.73 g/mol |
| Exact Mass | 597.03 |
| IUPAC Name | N-[2-[2-(2-methoxyanilino)-2-oxoethyl]sulfanyl-1,3-benzothiazol-6-yl]-2-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]acetamide |
| SMILES | COc1ccccc1NC(=O)CSc1nc2ccc(NC(=O)CSc3nc4ccc([N+](=O)[O-])cc4s3)cc2s1 |
| InChI | InChI=1S/C25H19N5O5S4/c1-35-19-5-3-2-4-16(19)27-23(32)13-37-24-28-17-8-6-14(10-20(17)38-24)26-22(31)12-36-25-29-18-9-7-15(30(33)34)11-21(18)39-25/h2-11H,12-13H2,1H3,(H,26,31)(H,27,32) |
| InChIKey | RJTHWYLLFZTTPY-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 136.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.73 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|