C16H10F3N3O3S2 — CID 1121359
2-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 1121359) has the molecular formula C16H10F3N3O3S2 and a molecular weight of 413.40 g/mol. Its IUPAC name is 2-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 1121359 |
| Molecular Formula | C16H10F3N3O3S2 |
| Molecular Weight | 413.40 g/mol |
| Exact Mass | 413.01 |
| IUPAC Name | 2-[(6-nitro-1,3-benzothiazol-2-yl)sulfanyl]-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | O=C(CSc1nc2ccc([N+](=O)[O-])cc2s1)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C16H10F3N3O3S2/c17-16(18,19)10-3-1-2-4-11(10)20-14(23)8-26-15-21-12-6-5-9(22(24)25)7-13(12)27-15/h1-7H,8H2,(H,20,23) |
| InChIKey | DEPVHGLRSOPTEG-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.40 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|