C24H20N4O5S2 — CID 23774982
N-[2-[2-(2-ethoxyanilino)-2-oxoethyl]sulfanyl-1,3-benzothiazol-6-yl]-4-nitrobenzamide (PubChem CID 23774982) has the molecular formula C24H20N4O5S2 and a molecular weight of 508.58 g/mol. Its IUPAC name is N-[2-[2-(2-ethoxyanilino)-2-oxoethyl]sulfanyl-1,3-benzothiazol-6-yl]-4-nitrobenzamide.
| Compound Name | N-[2-[2-(2-ethoxyanilino)-2-oxoethyl]sulfanyl-1,3-benzothiazol-6-yl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 23774982 |
| Molecular Formula | C24H20N4O5S2 |
| Molecular Weight | 508.58 g/mol |
| Exact Mass | 508.09 |
| IUPAC Name | N-[2-[2-(2-ethoxyanilino)-2-oxoethyl]sulfanyl-1,3-benzothiazol-6-yl]-4-nitrobenzamide |
| SMILES | CCOc1ccccc1NC(=O)CSc1nc2ccc(NC(=O)c3ccc([N+](=O)[O-])cc3)cc2s1 |
| InChI | InChI=1S/C24H20N4O5S2/c1-2-33-20-6-4-3-5-18(20)26-22(29)14-34-24-27-19-12-9-16(13-21(19)35-24)25-23(30)15-7-10-17(11-8-15)28(31)32/h3-13H,2,14H2,1H3,(H,25,30)(H,26,29) |
| InChIKey | XRDLQNYYQMWQOH-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 123.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.58 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|