C27H26N4O5S2 — CID 23966578
4-tert-butyl-N-[2-[2-(4-methoxy-2-nitroanilino)-2-oxoethyl]sulfanyl-1,3-benzothiazol-6-yl]benzamide (PubChem CID 23966578) has the molecular formula C27H26N4O5S2 and a molecular weight of 550.66 g/mol. Its IUPAC name is 4-tert-butyl-N-[2-[2-(4-methoxy-2-nitroanilino)-2-oxoethyl]sulfanyl-1,3-benzothiazol-6-yl]benzamide.
| Compound Name | 4-tert-butyl-N-[2-[2-(4-methoxy-2-nitroanilino)-2-oxoethyl]sulfanyl-1,3-benzothiazol-6-yl]benzamide |
|---|---|
| PubChem CID | 23966578 |
| Molecular Formula | C27H26N4O5S2 |
| Molecular Weight | 550.66 g/mol |
| Exact Mass | 550.13 |
| IUPAC Name | 4-tert-butyl-N-[2-[2-(4-methoxy-2-nitroanilino)-2-oxoethyl]sulfanyl-1,3-benzothiazol-6-yl]benzamide |
| SMILES | COc1ccc(NC(=O)CSc2nc3ccc(NC(=O)c4ccc(C(C)(C)C)cc4)cc3s2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C27H26N4O5S2/c1-27(2,3)17-7-5-16(6-8-17)25(33)28-18-9-11-21-23(13-18)38-26(30-21)37-15-24(32)29-20-12-10-19(36-4)14-22(20)31(34)35/h5-14H,15H2,1-4H3,(H,28,33)(H,29,32) |
| InChIKey | SULCBGHLVOQQPR-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 123.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.66 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|