C19H26N2O3S2 — CID 2751835
octyl 2-[(6-acetamido-1,3-benzothiazol-2-yl)sulfanyl]acetate (PubChem CID 2751835) has the molecular formula C19H26N2O3S2 and a molecular weight of 394.56 g/mol. Its IUPAC name is octyl 2-[(6-acetamido-1,3-benzothiazol-2-yl)sulfanyl]acetate.
| Compound Name | octyl 2-[(6-acetamido-1,3-benzothiazol-2-yl)sulfanyl]acetate |
|---|---|
| PubChem CID | 2751835 |
| Molecular Formula | C19H26N2O3S2 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.14 |
| IUPAC Name | octyl 2-[(6-acetamido-1,3-benzothiazol-2-yl)sulfanyl]acetate |
| SMILES | CCCCCCCCOC(=O)CSc1nc2ccc(NC(C)=O)cc2s1 |
| InChI | InChI=1S/C19H26N2O3S2/c1-3-4-5-6-7-8-11-24-18(23)13-25-19-21-16-10-9-15(20-14(2)22)12-17(16)26-19/h9-10,12H,3-8,11,13H2,1-2H3,(H,20,22) |
| InChIKey | KMDMRNAKIUGONG-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|