2-[(6-acetamido-1,3-benzothiazol-2-yl)sulfanyl]acetic acid

C11H10N2O3S2 — CID 653086

IUPAC2-[(6-acetamido-1,3-benzothiazol-2-yl)sulfanyl]acetic acid
SMILESCC(=O)Nc1ccc2nc(SCC(=O)O)sc2c1
InChIInChI=1S/C11H10N2O3S2/c1-6(14)12-7-2-3-8-9(4-7)18-11(13-8)17-5-10(15)16/h2-4H,5H2,1H3,(H,12,14)(H,15,16)
InChIKeyDSRHSCKCDGMHEA-UHFFFAOYSA-N
MW282.35 g/mol
LogP2.43
Rot. Bonds4

About 2-[(6-acetamido-1,3-benzothiazol-2-yl)sulfanyl]acetic acid

2-[(6-acetamido-1,3-benzothiazol-2-yl)sulfanyl]acetic acid (PubChem CID 653086) has the molecular formula C11H10N2O3S2 and a molecular weight of 282.35 g/mol. Its IUPAC name is 2-[(6-acetamido-1,3-benzothiazol-2-yl)sulfanyl]acetic acid.

Molecular Properties

Compound Name2-[(6-acetamido-1,3-benzothiazol-2-yl)sulfanyl]acetic acid
PubChem CID653086
Molecular FormulaC11H10N2O3S2
Molecular Weight282.35 g/mol
Exact Mass282.01
IUPAC Name2-[(6-acetamido-1,3-benzothiazol-2-yl)sulfanyl]acetic acid
SMILESCC(=O)Nc1ccc2nc(SCC(=O)O)sc2c1
InChIInChI=1S/C11H10N2O3S2/c1-6(14)12-7-2-3-8-9(4-7)18-11(13-8)17-5-10(15)16/h2-4H,5H2,1H3,(H,12,14)(H,15,16)
InChIKeyDSRHSCKCDGMHEA-UHFFFAOYSA-N
XLogP2.43
TPSA79.29 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500282.35
LogP ≤ 52.43
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze 2-[(6-acetamido-1,3-benzothiazol-2-yl)sulfanyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(6-acetamido-1,3-benzothiazol-2-yl)sulfanyl]acetic acid?
The IUPAC name of 2-[(6-acetamido-1,3-benzothiazol-2-yl)sulfanyl]acetic acid (CID 653086) is 2-[(6-acetamido-1,3-benzothiazol-2-yl)sulfanyl]acetic acid.
What is the SMILES notation for 2-[(6-acetamido-1,3-benzothiazol-2-yl)sulfanyl]acetic acid?
The canonical SMILES for 2-[(6-acetamido-1,3-benzothiazol-2-yl)sulfanyl]acetic acid is CC(=O)Nc1ccc2nc(SCC(=O)O)sc2c1.
What is the InChIKey of 2-[(6-acetamido-1,3-benzothiazol-2-yl)sulfanyl]acetic acid?
The InChIKey is DSRHSCKCDGMHEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N2O3S2/c1-6(14)12-7-2-3-8-9(4-7)18-11(13-8)17-5-10(15)16/h2-4H,5H2,1H3,(H,12,14)(H,15,16).
What are the key properties of 2-[(6-acetamido-1,3-benzothiazol-2-yl)sulfanyl]acetic acid?
2-[(6-acetamido-1,3-benzothiazol-2-yl)sulfanyl]acetic acid has a molecular weight of 282.35 g/mol, XLogP of 2.43, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(6-acetamido-1,3-benzothiazol-2-yl)sulfanyl]acetic acid is sourced from PubChem (CID 653086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).