C11H10N2O3S2 — CID 653086
2-[(6-acetamido-1,3-benzothiazol-2-yl)sulfanyl]acetic acid (PubChem CID 653086) has the molecular formula C11H10N2O3S2 and a molecular weight of 282.35 g/mol. Its IUPAC name is 2-[(6-acetamido-1,3-benzothiazol-2-yl)sulfanyl]acetic acid.
| Compound Name | 2-[(6-acetamido-1,3-benzothiazol-2-yl)sulfanyl]acetic acid |
|---|---|
| PubChem CID | 653086 |
| Molecular Formula | C11H10N2O3S2 |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.01 |
| IUPAC Name | 2-[(6-acetamido-1,3-benzothiazol-2-yl)sulfanyl]acetic acid |
| SMILES | CC(=O)Nc1ccc2nc(SCC(=O)O)sc2c1 |
| InChI | InChI=1S/C11H10N2O3S2/c1-6(14)12-7-2-3-8-9(4-7)18-11(13-8)17-5-10(15)16/h2-4H,5H2,1H3,(H,12,14)(H,15,16) |
| InChIKey | DSRHSCKCDGMHEA-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |