C16H20N2O3S2 — CID 2751832
pentyl 2-[(6-acetamido-1,3-benzothiazol-2-yl)sulfanyl]acetate (PubChem CID 2751832) has the molecular formula C16H20N2O3S2 and a molecular weight of 352.48 g/mol. Its IUPAC name is pentyl 2-[(6-acetamido-1,3-benzothiazol-2-yl)sulfanyl]acetate.
| Compound Name | pentyl 2-[(6-acetamido-1,3-benzothiazol-2-yl)sulfanyl]acetate |
|---|---|
| PubChem CID | 2751832 |
| Molecular Formula | C16H20N2O3S2 |
| Molecular Weight | 352.48 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | pentyl 2-[(6-acetamido-1,3-benzothiazol-2-yl)sulfanyl]acetate |
| SMILES | CCCCCOC(=O)CSc1nc2ccc(NC(C)=O)cc2s1 |
| InChI | InChI=1S/C16H20N2O3S2/c1-3-4-5-8-21-15(20)10-22-16-18-13-7-6-12(17-11(2)19)9-14(13)23-16/h6-7,9H,3-5,8,10H2,1-2H3,(H,17,19) |
| InChIKey | WKQATVGGNQRUBU-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.48 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|