C18H16N2O2S2 — CID 7465319
N-[4-[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]phenyl]propanamide (PubChem CID 7465319) has the molecular formula C18H16N2O2S2 and a molecular weight of 356.47 g/mol. Its IUPAC name is N-[4-[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]phenyl]propanamide.
| Compound Name | N-[4-[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]phenyl]propanamide |
|---|---|
| PubChem CID | 7465319 |
| Molecular Formula | C18H16N2O2S2 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.07 |
| IUPAC Name | N-[4-[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]phenyl]propanamide |
| SMILES | CCC(=O)Nc1ccc(C(=O)CSc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C18H16N2O2S2/c1-2-17(22)19-13-9-7-12(8-10-13)15(21)11-23-18-20-14-5-3-4-6-16(14)24-18/h3-10H,2,11H2,1H3,(H,19,22) |
| InChIKey | JMJKOSPFJBPAGR-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |