C17H14N2O2S2 — CID 687281
N-(4-acetylphenyl)-2-(1,3-benzothiazol-2-ylsulfanyl)acetamide (PubChem CID 687281) has the molecular formula C17H14N2O2S2 and a molecular weight of 342.45 g/mol. Its IUPAC name is N-(4-acetylphenyl)-2-(1,3-benzothiazol-2-ylsulfanyl)acetamide.
| Compound Name | N-(4-acetylphenyl)-2-(1,3-benzothiazol-2-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 687281 |
| Molecular Formula | C17H14N2O2S2 |
| Molecular Weight | 342.45 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | N-(4-acetylphenyl)-2-(1,3-benzothiazol-2-ylsulfanyl)acetamide |
| SMILES | CC(=O)c1ccc(NC(=O)CSc2nc3ccccc3s2)cc1 |
| InChI | InChI=1S/C17H14N2O2S2/c1-11(20)12-6-8-13(9-7-12)18-16(21)10-22-17-19-14-4-2-3-5-15(14)23-17/h2-9H,10H2,1H3,(H,18,21) |
| InChIKey | QCYWYEQBHUMGAG-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.45 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |