C16H12N2O3S2 — CID 742353
3-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]amino]benzoic acid (PubChem CID 742353) has the molecular formula C16H12N2O3S2 and a molecular weight of 344.42 g/mol. Its IUPAC name is 3-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]amino]benzoic acid.
| Compound Name | 3-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]amino]benzoic acid |
|---|---|
| PubChem CID | 742353 |
| Molecular Formula | C16H12N2O3S2 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.03 |
| IUPAC Name | 3-[[2-(1,3-benzothiazol-2-ylsulfanyl)acetyl]amino]benzoic acid |
| SMILES | O=C(CSc1nc2ccccc2s1)Nc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C16H12N2O3S2/c19-14(17-11-5-3-4-10(8-11)15(20)21)9-22-16-18-12-6-1-2-7-13(12)23-16/h1-8H,9H2,(H,17,19)(H,20,21) |
| InChIKey | YAKFLPDNDTVXBZ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |