C19H23N3O4S2 — CID 46683789
butyl 4-[[2-[[5-(2-amino-2-oxoethyl)-4-methyl-1,3-thiazol-2-yl]sulfanyl]acetyl]amino]benzoate (PubChem CID 46683789) has the molecular formula C19H23N3O4S2 and a molecular weight of 421.54 g/mol. Its IUPAC name is butyl 4-[[2-[[5-(2-amino-2-oxoethyl)-4-methyl-1,3-thiazol-2-yl]sulfanyl]acetyl]amino]benzoate.
| Compound Name | butyl 4-[[2-[[5-(2-amino-2-oxoethyl)-4-methyl-1,3-thiazol-2-yl]sulfanyl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 46683789 |
| Molecular Formula | C19H23N3O4S2 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | butyl 4-[[2-[[5-(2-amino-2-oxoethyl)-4-methyl-1,3-thiazol-2-yl]sulfanyl]acetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)CSc2nc(C)c(CC(N)=O)s2)cc1 |
| InChI | InChI=1S/C19H23N3O4S2/c1-3-4-9-26-18(25)13-5-7-14(8-6-13)22-17(24)11-27-19-21-12(2)15(28-19)10-16(20)23/h5-8H,3-4,9-11H2,1-2H3,(H2,20,23)(H,22,24) |
| InChIKey | RTTHSOSDXQIMRH-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 111.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|