C18H22N2O4S — CID 55518313
butyl 4-[[2-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]acetyl]amino]benzoate (PubChem CID 55518313) has the molecular formula C18H22N2O4S and a molecular weight of 362.45 g/mol. Its IUPAC name is butyl 4-[[2-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]acetyl]amino]benzoate.
| Compound Name | butyl 4-[[2-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]acetyl]amino]benzoate |
|---|---|
| PubChem CID | 55518313 |
| Molecular Formula | C18H22N2O4S |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | butyl 4-[[2-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]acetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)CSc2nc(C)c(C)o2)cc1 |
| InChI | InChI=1S/C18H22N2O4S/c1-4-5-10-23-17(22)14-6-8-15(9-7-14)20-16(21)11-25-18-19-12(2)13(3)24-18/h6-9H,4-5,10-11H2,1-3H3,(H,20,21) |
| InChIKey | XBFUJHXNWVXOCZ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 81.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|