C13H14N2O2S — CID 9456919
2-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]-N-phenylacetamide (PubChem CID 9456919) has the molecular formula C13H14N2O2S and a molecular weight of 262.33 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]-N-phenylacetamide.
| Compound Name | 2-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]-N-phenylacetamide |
|---|---|
| PubChem CID | 9456919 |
| Molecular Formula | C13H14N2O2S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.08 |
| IUPAC Name | 2-[(4,5-dimethyl-1,3-oxazol-2-yl)sulfanyl]-N-phenylacetamide |
| SMILES | Cc1nc(SCC(=O)Nc2ccccc2)oc1C |
| InChI | InChI=1S/C13H14N2O2S/c1-9-10(2)17-13(14-9)18-8-12(16)15-11-6-4-3-5-7-11/h3-7H,8H2,1-2H3,(H,15,16) |
| InChIKey | SGQFGXBFAOSKCV-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |