C25H32N2O4S — CID 23094983
butyl 4-[[2-[4-(3,3-dimethylbutanoylamino)phenyl]sulfanylacetyl]amino]benzoate (PubChem CID 23094983) has the molecular formula C25H32N2O4S and a molecular weight of 456.61 g/mol. Its IUPAC name is butyl 4-[[2-[4-(3,3-dimethylbutanoylamino)phenyl]sulfanylacetyl]amino]benzoate.
| Compound Name | butyl 4-[[2-[4-(3,3-dimethylbutanoylamino)phenyl]sulfanylacetyl]amino]benzoate |
|---|---|
| PubChem CID | 23094983 |
| Molecular Formula | C25H32N2O4S |
| Molecular Weight | 456.61 g/mol |
| Exact Mass | 456.21 |
| IUPAC Name | butyl 4-[[2-[4-(3,3-dimethylbutanoylamino)phenyl]sulfanylacetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)CSc2ccc(NC(=O)CC(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C25H32N2O4S/c1-5-6-15-31-24(30)18-7-9-19(10-8-18)27-23(29)17-32-21-13-11-20(12-14-21)26-22(28)16-25(2,3)4/h7-14H,5-6,15-17H2,1-4H3,(H,26,28)(H,27,29) |
| InChIKey | OOTDBSSSKGRXAK-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.61 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|