C23H31N3O3S — CID 7492327
butyl 4-[[2-(1-cyclopentyl-4,5-dimethylimidazol-2-yl)sulfanylacetyl]amino]benzoate (PubChem CID 7492327) has the molecular formula C23H31N3O3S and a molecular weight of 429.59 g/mol. Its IUPAC name is butyl 4-[[2-(1-cyclopentyl-4,5-dimethylimidazol-2-yl)sulfanylacetyl]amino]benzoate.
| Compound Name | butyl 4-[[2-(1-cyclopentyl-4,5-dimethylimidazol-2-yl)sulfanylacetyl]amino]benzoate |
|---|---|
| PubChem CID | 7492327 |
| Molecular Formula | C23H31N3O3S |
| Molecular Weight | 429.59 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | butyl 4-[[2-(1-cyclopentyl-4,5-dimethylimidazol-2-yl)sulfanylacetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccc(NC(=O)CSc2nc(C)c(C)n2C2CCCC2)cc1 |
| InChI | InChI=1S/C23H31N3O3S/c1-4-5-14-29-22(28)18-10-12-19(13-11-18)25-21(27)15-30-23-24-16(2)17(3)26(23)20-8-6-7-9-20/h10-13,20H,4-9,14-15H2,1-3H3,(H,25,27) |
| InChIKey | PJETWPPQUMZGJZ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.59 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|