C21H30N4OS — CID 60545973
2-(1-cyclohexyl-4,5-dimethylimidazol-2-yl)sulfanyl-N-[4-(dimethylamino)phenyl]acetamide (PubChem CID 60545973) has the molecular formula C21H30N4OS and a molecular weight of 386.57 g/mol. Its IUPAC name is 2-(1-cyclohexyl-4,5-dimethylimidazol-2-yl)sulfanyl-N-[4-(dimethylamino)phenyl]acetamide.
| Compound Name | 2-(1-cyclohexyl-4,5-dimethylimidazol-2-yl)sulfanyl-N-[4-(dimethylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 60545973 |
| Molecular Formula | C21H30N4OS |
| Molecular Weight | 386.57 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | 2-(1-cyclohexyl-4,5-dimethylimidazol-2-yl)sulfanyl-N-[4-(dimethylamino)phenyl]acetamide |
| SMILES | Cc1nc(SCC(=O)Nc2ccc(N(C)C)cc2)n(C2CCCCC2)c1C |
| InChI | InChI=1S/C21H30N4OS/c1-15-16(2)25(19-8-6-5-7-9-19)21(22-15)27-14-20(26)23-17-10-12-18(13-11-17)24(3)4/h10-13,19H,5-9,14H2,1-4H3,(H,23,26) |
| InChIKey | CUVLNQUUDMQKGH-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.57 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|