C23H32N4OS — CID 9291207
2-(1-cyclohexyl-4,5-dimethylimidazol-2-yl)sulfanyl-N-(4-pyrrolidin-1-ylphenyl)acetamide (PubChem CID 9291207) has the molecular formula C23H32N4OS and a molecular weight of 412.60 g/mol. Its IUPAC name is 2-(1-cyclohexyl-4,5-dimethylimidazol-2-yl)sulfanyl-N-(4-pyrrolidin-1-ylphenyl)acetamide.
| Compound Name | 2-(1-cyclohexyl-4,5-dimethylimidazol-2-yl)sulfanyl-N-(4-pyrrolidin-1-ylphenyl)acetamide |
|---|---|
| PubChem CID | 9291207 |
| Molecular Formula | C23H32N4OS |
| Molecular Weight | 412.60 g/mol |
| Exact Mass | 412.23 |
| IUPAC Name | 2-(1-cyclohexyl-4,5-dimethylimidazol-2-yl)sulfanyl-N-(4-pyrrolidin-1-ylphenyl)acetamide |
| SMILES | Cc1nc(SCC(=O)Nc2ccc(N3CCCC3)cc2)n(C2CCCCC2)c1C |
| InChI | InChI=1S/C23H32N4OS/c1-17-18(2)27(21-8-4-3-5-9-21)23(24-17)29-16-22(28)25-19-10-12-20(13-11-19)26-14-6-7-15-26/h10-13,21H,3-9,14-16H2,1-2H3,(H,25,28) |
| InChIKey | FITQPFZGMYKCBY-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.60 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|