C27H18N2O2S2Zn — CID 143715432
2-[2-[[2-(1,3-benzothiazol-2-yl)phenoxy]methoxy]phenyl]-1,3-benzothiazole;zinc (PubChem CID 143715432) has the molecular formula C27H18N2O2S2Zn and a molecular weight of 531.98 g/mol. Its IUPAC name is 2-[2-[[2-(1,3-benzothiazol-2-yl)phenoxy]methoxy]phenyl]-1,3-benzothiazole;zinc.
| Compound Name | 2-[2-[[2-(1,3-benzothiazol-2-yl)phenoxy]methoxy]phenyl]-1,3-benzothiazole;zinc |
|---|---|
| PubChem CID | 143715432 |
| Molecular Formula | C27H18N2O2S2Zn |
| Molecular Weight | 531.98 g/mol |
| Exact Mass | 530.01 |
| IUPAC Name | 2-[2-[[2-(1,3-benzothiazol-2-yl)phenoxy]methoxy]phenyl]-1,3-benzothiazole;zinc |
| SMILES | [Zn].c1ccc(-c2nc3ccccc3s2)c(OCOc2ccccc2-c2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C27H18N2O2S2.Zn/c1-5-13-22(18(9-1)26-28-20-11-3-7-15-24(20)32-26)30-17-31-23-14-6-2-10-19(23)27-29-21-12-4-8-16-25(21)33-27;/h1-16H,17H2; |
| InChIKey | VCNNXPWBOISWFU-UHFFFAOYSA-N |
| XLogP | 7.65 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.98 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|