C24H21N5OS — CID 176507431
2-[2-[4-(4-pyridin-2-yltriazol-1-yl)butoxy]phenyl]-1,3-benzothiazole (PubChem CID 176507431) has the molecular formula C24H21N5OS and a molecular weight of 427.53 g/mol. Its IUPAC name is 2-[2-[4-(4-pyridin-2-yltriazol-1-yl)butoxy]phenyl]-1,3-benzothiazole.
| Compound Name | 2-[2-[4-(4-pyridin-2-yltriazol-1-yl)butoxy]phenyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 176507431 |
| Molecular Formula | C24H21N5OS |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.15 |
| IUPAC Name | 2-[2-[4-(4-pyridin-2-yltriazol-1-yl)butoxy]phenyl]-1,3-benzothiazole |
| SMILES | c1ccc(-c2cn(CCCCOc3ccccc3-c3nc4ccccc4s3)nn2)nc1 |
| InChI | InChI=1S/C24H21N5OS/c1-3-12-22(18(9-1)24-26-20-11-2-4-13-23(20)31-24)30-16-8-7-15-29-17-21(27-28-29)19-10-5-6-14-25-19/h1-6,9-14,17H,7-8,15-16H2 |
| InChIKey | QPZDWVIHARPVFH-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 65.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|