C25H26N4O — CID 86305870
3-[1-[6-(2-phenylphenoxy)hexyl]triazol-4-yl]pyridine (PubChem CID 86305870) has the molecular formula C25H26N4O and a molecular weight of 398.51 g/mol. Its IUPAC name is 3-[1-[6-(2-phenylphenoxy)hexyl]triazol-4-yl]pyridine.
| Compound Name | 3-[1-[6-(2-phenylphenoxy)hexyl]triazol-4-yl]pyridine |
|---|---|
| PubChem CID | 86305870 |
| Molecular Formula | C25H26N4O |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 3-[1-[6-(2-phenylphenoxy)hexyl]triazol-4-yl]pyridine |
| SMILES | c1ccc(-c2ccccc2OCCCCCCn2cc(-c3cccnc3)nn2)cc1 |
| InChI | InChI=1S/C25H26N4O/c1(8-17-29-20-24(27-28-29)22-13-10-16-26-19-22)2-9-18-30-25-15-7-6-14-23(25)21-11-4-3-5-12-21/h3-7,10-16,19-20H,1-2,8-9,17-18H2 |
| InChIKey | FJNODUYSFLYNDI-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|