C14H22N5+ — CID 71725787
trimethyl-[4-(4-pyridin-2-yltriazol-1-yl)butyl]azanium (PubChem CID 71725787) has the molecular formula C14H22N5+ and a molecular weight of 260.37 g/mol. Its IUPAC name is trimethyl-[4-(4-pyridin-2-yltriazol-1-yl)butyl]azanium.
| Compound Name | trimethyl-[4-(4-pyridin-2-yltriazol-1-yl)butyl]azanium |
|---|---|
| PubChem CID | 71725787 |
| Molecular Formula | C14H22N5+ |
| Molecular Weight | 260.37 g/mol |
| Exact Mass | 260.19 |
| IUPAC Name | trimethyl-[4-(4-pyridin-2-yltriazol-1-yl)butyl]azanium |
| SMILES | C[N+](C)(C)CCCCn1cc(-c2ccccn2)nn1 |
| InChI | InChI=1S/C14H22N5/c1-19(2,3)11-7-6-10-18-12-14(16-17-18)13-8-4-5-9-15-13/h4-5,8-9,12H,6-7,10-11H2,1-3H3/q+1 |
| InChIKey | SSYGIMUGRWQXBD-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.37 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|