About propane;2-pyridin-2-ylpyridine
propane;2-pyridin-2-ylpyridine (PubChem CID 158168510) has the molecular formula C13H16N2
and a molecular weight of 200.29 g/mol. Its IUPAC name is propane;2-pyridin-2-ylpyridine.
Molecular Properties
| Compound Name | propane;2-pyridin-2-ylpyridine |
| PubChem CID | 158168510 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.29 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | propane;2-pyridin-2-ylpyridine |
| SMILES | CCC.c1ccc(-c2ccccn2)nc1 |
| InChI | InChI=1S/C10H8N2.C3H8/c1-3-7-11-9(5-1)10-6-2-4-8-12-10;1-3-2/h1-8H;3H2,1-2H3 |
| InChIKey | FXDMLZQWWSUMTH-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.29 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze propane;2-pyridin-2-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propane;2-pyridin-2-ylpyridine?
The IUPAC name of propane;2-pyridin-2-ylpyridine (CID 158168510) is propane;2-pyridin-2-ylpyridine.
What is the SMILES notation for propane;2-pyridin-2-ylpyridine?
The canonical SMILES for propane;2-pyridin-2-ylpyridine is CCC.c1ccc(-c2ccccn2)nc1.
What is the InChIKey of propane;2-pyridin-2-ylpyridine?
The InChIKey is FXDMLZQWWSUMTH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2.C3H8/c1-3-7-11-9(5-1)10-6-2-4-8-12-10;1-3-2/h1-8H;3H2,1-2H3.
What are the key properties of propane;2-pyridin-2-ylpyridine?
propane;2-pyridin-2-ylpyridine has a molecular weight of 200.29 g/mol, XLogP of 3.56, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propane;2-pyridin-2-ylpyridine is sourced from PubChem (CID 158168510), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).