About 2-pyridin-2-ylpyridine;hydroiodide
2-pyridin-2-ylpyridine;hydroiodide (PubChem CID 172833113) has the molecular formula C10H9IN2
and a molecular weight of 284.10 g/mol. Its IUPAC name is 2-pyridin-2-ylpyridine;hydroiodide.
Molecular Properties
| Compound Name | 2-pyridin-2-ylpyridine;hydroiodide |
| PubChem CID | 172833113 |
| Molecular Formula | C10H9IN2 |
| Molecular Weight | 284.10 g/mol |
| Exact Mass | 283.98 |
| IUPAC Name | 2-pyridin-2-ylpyridine;hydroiodide |
| SMILES | I.c1ccc(-c2ccccn2)nc1 |
| InChI | InChI=1S/C10H8N2.HI/c1-3-7-11-9(5-1)10-6-2-4-8-12-10;/h1-8H;1H |
| InChIKey | VTXXEGRVXXQRJY-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.10 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-pyridin-2-ylpyridine;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyridin-2-ylpyridine;hydroiodide?
The IUPAC name of 2-pyridin-2-ylpyridine;hydroiodide (CID 172833113) is 2-pyridin-2-ylpyridine;hydroiodide.
What is the SMILES notation for 2-pyridin-2-ylpyridine;hydroiodide?
The canonical SMILES for 2-pyridin-2-ylpyridine;hydroiodide is I.c1ccc(-c2ccccn2)nc1.
What is the InChIKey of 2-pyridin-2-ylpyridine;hydroiodide?
The InChIKey is VTXXEGRVXXQRJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2.HI/c1-3-7-11-9(5-1)10-6-2-4-8-12-10;/h1-8H;1H.
What are the key properties of 2-pyridin-2-ylpyridine;hydroiodide?
2-pyridin-2-ylpyridine;hydroiodide has a molecular weight of 284.10 g/mol, XLogP of 2.76, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyridin-2-ylpyridine;hydroiodide is sourced from PubChem (CID 172833113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).