About carbon monoxide;2-pyridin-2-ylpyridine;rhenium
carbon monoxide;2-pyridin-2-ylpyridine;rhenium (PubChem CID 139182627) has the molecular formula C13H8N2O3Re
and a molecular weight of 426.43 g/mol. Its IUPAC name is carbon monoxide;2-pyridin-2-ylpyridine;rhenium.
Molecular Properties
| Compound Name | carbon monoxide;2-pyridin-2-ylpyridine;rhenium |
| PubChem CID | 139182627 |
| Molecular Formula | C13H8N2O3Re |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 427.01 |
| IUPAC Name | carbon monoxide;2-pyridin-2-ylpyridine;rhenium |
| SMILES | [C-]#[O+].[C-]#[O+].[C-]#[O+].[Re].c1ccc(-c2ccccn2)nc1 |
| InChI | InChI=1S/C10H8N2.3CO.Re/c1-3-7-11-9(5-1)10-6-2-4-8-12-10;3*1-2;/h1-8H;;;; |
| InChIKey | SOHSKSPGKYODJQ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 85.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze carbon monoxide;2-pyridin-2-ylpyridine;rhenium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon monoxide;2-pyridin-2-ylpyridine;rhenium?
The IUPAC name of carbon monoxide;2-pyridin-2-ylpyridine;rhenium (CID 139182627) is carbon monoxide;2-pyridin-2-ylpyridine;rhenium.
What is the SMILES notation for carbon monoxide;2-pyridin-2-ylpyridine;rhenium?
The canonical SMILES for carbon monoxide;2-pyridin-2-ylpyridine;rhenium is [C-]#[O+].[C-]#[O+].[C-]#[O+].[Re].c1ccc(-c2ccccn2)nc1.
What is the InChIKey of carbon monoxide;2-pyridin-2-ylpyridine;rhenium?
The InChIKey is SOHSKSPGKYODJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2.3CO.Re/c1-3-7-11-9(5-1)10-6-2-4-8-12-10;3*1-2;/h1-8H;;;;.
What are the key properties of carbon monoxide;2-pyridin-2-ylpyridine;rhenium?
carbon monoxide;2-pyridin-2-ylpyridine;rhenium has a molecular weight of 426.43 g/mol, XLogP of 2.03, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbon monoxide;2-pyridin-2-ylpyridine;rhenium is sourced from PubChem (CID 139182627), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).