About 2-pyridin-2-ylpyridine;ruthenium(2+)
2-pyridin-2-ylpyridine;ruthenium(2+) (PubChem CID 140596360) has the molecular formula C10H8N2Ru+2
and a molecular weight of 257.26 g/mol. Its IUPAC name is 2-pyridin-2-ylpyridine;ruthenium(2+).
Molecular Properties
| Compound Name | 2-pyridin-2-ylpyridine;ruthenium(2+) |
| PubChem CID | 140596360 |
| Molecular Formula | C10H8N2Ru+2 |
| Molecular Weight | 257.26 g/mol |
| Exact Mass | 257.97 |
| IUPAC Name | 2-pyridin-2-ylpyridine;ruthenium(2+) |
| SMILES | [Ru+2].c1ccc(-c2ccccn2)nc1 |
| InChI | InChI=1S/C10H8N2.Ru/c1-3-7-11-9(5-1)10-6-2-4-8-12-10;/h1-8H;/q;+2 |
| InChIKey | WCZXPQZPDFKPGH-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.26 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-pyridin-2-ylpyridine;ruthenium(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyridin-2-ylpyridine;ruthenium(2+)?
The IUPAC name of 2-pyridin-2-ylpyridine;ruthenium(2+) (CID 140596360) is 2-pyridin-2-ylpyridine;ruthenium(2+).
What is the SMILES notation for 2-pyridin-2-ylpyridine;ruthenium(2+)?
The canonical SMILES for 2-pyridin-2-ylpyridine;ruthenium(2+) is [Ru+2].c1ccc(-c2ccccn2)nc1.
What is the InChIKey of 2-pyridin-2-ylpyridine;ruthenium(2+)?
The InChIKey is WCZXPQZPDFKPGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2.Ru/c1-3-7-11-9(5-1)10-6-2-4-8-12-10;/h1-8H;/q;+2.
What are the key properties of 2-pyridin-2-ylpyridine;ruthenium(2+)?
2-pyridin-2-ylpyridine;ruthenium(2+) has a molecular weight of 257.26 g/mol, XLogP of 2.14, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyridin-2-ylpyridine;ruthenium(2+) is sourced from PubChem (CID 140596360), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).