About 2-pyridin-2-ylpyridine;rhenium;tetrachloride
2-pyridin-2-ylpyridine;rhenium;tetrachloride (PubChem CID 52939847) has the molecular formula C10H8Cl4N2Re-4
and a molecular weight of 484.21 g/mol. Its IUPAC name is 2-pyridin-2-ylpyridine;rhenium;tetrachloride.
Molecular Properties
| Compound Name | 2-pyridin-2-ylpyridine;rhenium;tetrachloride |
| PubChem CID | 52939847 |
| Molecular Formula | C10H8Cl4N2Re-4 |
| Molecular Weight | 484.21 g/mol |
| Exact Mass | 482.90 |
| IUPAC Name | 2-pyridin-2-ylpyridine;rhenium;tetrachloride |
| SMILES | [Cl-].[Cl-].[Cl-].[Cl-].[Re].c1ccc(-c2ccccn2)nc1 |
| InChI | InChI=1S/C10H8N2.4ClH.Re/c1-3-7-11-9(5-1)10-6-2-4-8-12-10;;;;;/h1-8H;4*1H;/p-4 |
| InChIKey | WQZWQUPXRBXEEA-UHFFFAOYSA-J |
| XLogP | -9.84 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 484.21 |
| LogP ≤ 5 | -9.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-pyridin-2-ylpyridine;rhenium;tetrachloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyridin-2-ylpyridine;rhenium;tetrachloride?
The IUPAC name of 2-pyridin-2-ylpyridine;rhenium;tetrachloride (CID 52939847) is 2-pyridin-2-ylpyridine;rhenium;tetrachloride.
What is the SMILES notation for 2-pyridin-2-ylpyridine;rhenium;tetrachloride?
The canonical SMILES for 2-pyridin-2-ylpyridine;rhenium;tetrachloride is [Cl-].[Cl-].[Cl-].[Cl-].[Re].c1ccc(-c2ccccn2)nc1.
What is the InChIKey of 2-pyridin-2-ylpyridine;rhenium;tetrachloride?
The InChIKey is WQZWQUPXRBXEEA-UHFFFAOYSA-J. The full InChI is InChI=1S/C10H8N2.4ClH.Re/c1-3-7-11-9(5-1)10-6-2-4-8-12-10;;;;;/h1-8H;4*1H;/p-4.
What are the key properties of 2-pyridin-2-ylpyridine;rhenium;tetrachloride?
2-pyridin-2-ylpyridine;rhenium;tetrachloride has a molecular weight of 484.21 g/mol, XLogP of -9.84, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyridin-2-ylpyridine;rhenium;tetrachloride is sourced from PubChem (CID 52939847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).