About disodium;hydride;2-pyridin-2-ylpyridine
disodium;hydride;2-pyridin-2-ylpyridine (PubChem CID 174959125) has the molecular formula C10H10N2Na2
and a molecular weight of 204.18 g/mol. Its IUPAC name is disodium;hydride;2-pyridin-2-ylpyridine.
Molecular Properties
| Compound Name | disodium;hydride;2-pyridin-2-ylpyridine |
| PubChem CID | 174959125 |
| Molecular Formula | C10H10N2Na2 |
| Molecular Weight | 204.18 g/mol |
| Exact Mass | 204.06 |
| IUPAC Name | disodium;hydride;2-pyridin-2-ylpyridine |
| SMILES | [H-].[H-].[Na+].[Na+].c1ccc(-c2ccccn2)nc1 |
| InChI | InChI=1S/C10H8N2.2Na.2H/c1-3-7-11-9(5-1)10-6-2-4-8-12-10;;;;/h1-8H;;;;/q;2*+1;2*-1 |
| InChIKey | FYOLJZROUBQHMZ-UHFFFAOYSA-N |
| XLogP | -3.62 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.18 |
| LogP ≤ 5 | -3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze disodium;hydride;2-pyridin-2-ylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of disodium;hydride;2-pyridin-2-ylpyridine?
The IUPAC name of disodium;hydride;2-pyridin-2-ylpyridine (CID 174959125) is disodium;hydride;2-pyridin-2-ylpyridine.
What is the SMILES notation for disodium;hydride;2-pyridin-2-ylpyridine?
The canonical SMILES for disodium;hydride;2-pyridin-2-ylpyridine is [H-].[H-].[Na+].[Na+].c1ccc(-c2ccccn2)nc1.
What is the InChIKey of disodium;hydride;2-pyridin-2-ylpyridine?
The InChIKey is FYOLJZROUBQHMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2.2Na.2H/c1-3-7-11-9(5-1)10-6-2-4-8-12-10;;;;/h1-8H;;;;/q;2*+1;2*-1.
What are the key properties of disodium;hydride;2-pyridin-2-ylpyridine?
disodium;hydride;2-pyridin-2-ylpyridine has a molecular weight of 204.18 g/mol, XLogP of -3.62, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for disodium;hydride;2-pyridin-2-ylpyridine is sourced from PubChem (CID 174959125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).