About 2-pyridin-2-ylpyridine;trichloroiron
2-pyridin-2-ylpyridine;trichloroiron (PubChem CID 13245641) has the molecular formula C10H8Cl3FeN2
and a molecular weight of 318.39 g/mol. Its IUPAC name is 2-pyridin-2-ylpyridine;trichloroiron.
Molecular Properties
| Compound Name | 2-pyridin-2-ylpyridine;trichloroiron |
| PubChem CID | 13245641 |
| Molecular Formula | C10H8Cl3FeN2 |
| Molecular Weight | 318.39 g/mol |
| Exact Mass | 316.91 |
| IUPAC Name | 2-pyridin-2-ylpyridine;trichloroiron |
| SMILES | Cl[Fe](Cl)Cl.c1ccc(-c2ccccn2)nc1 |
| InChI | InChI=1S/C10H8N2.3ClH.Fe/c1-3-7-11-9(5-1)10-6-2-4-8-12-10;;;;/h1-8H;3*1H;/q;;;;+3/p-3 |
| InChIKey | MDCSDKSDNMGQGF-UHFFFAOYSA-K |
| XLogP | 4.21 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.39 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-pyridin-2-ylpyridine;trichloroiron with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-pyridin-2-ylpyridine;trichloroiron?
The IUPAC name of 2-pyridin-2-ylpyridine;trichloroiron (CID 13245641) is 2-pyridin-2-ylpyridine;trichloroiron.
What is the SMILES notation for 2-pyridin-2-ylpyridine;trichloroiron?
The canonical SMILES for 2-pyridin-2-ylpyridine;trichloroiron is Cl[Fe](Cl)Cl.c1ccc(-c2ccccn2)nc1.
What is the InChIKey of 2-pyridin-2-ylpyridine;trichloroiron?
The InChIKey is MDCSDKSDNMGQGF-UHFFFAOYSA-K. The full InChI is InChI=1S/C10H8N2.3ClH.Fe/c1-3-7-11-9(5-1)10-6-2-4-8-12-10;;;;/h1-8H;3*1H;/q;;;;+3/p-3.
What are the key properties of 2-pyridin-2-ylpyridine;trichloroiron?
2-pyridin-2-ylpyridine;trichloroiron has a molecular weight of 318.39 g/mol, XLogP of 4.21, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-pyridin-2-ylpyridine;trichloroiron is sourced from PubChem (CID 13245641), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).