C14H18N4O5 — CID 102277498
(2R,3R,4S,5R)-2-[2-(4-pyridin-2-yltriazol-1-yl)ethoxy]oxane-3,4,5-triol (PubChem CID 102277498) has the molecular formula C14H18N4O5 and a molecular weight of 322.32 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[2-(4-pyridin-2-yltriazol-1-yl)ethoxy]oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5R)-2-[2-(4-pyridin-2-yltriazol-1-yl)ethoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 102277498 |
| Molecular Formula | C14H18N4O5 |
| Molecular Weight | 322.32 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | (2R,3R,4S,5R)-2-[2-(4-pyridin-2-yltriazol-1-yl)ethoxy]oxane-3,4,5-triol |
| SMILES | O[C@@H]1[C@@H](O)[C@H](OCCn2cc(-c3ccccn3)nn2)OC[C@H]1O |
| InChI | InChI=1S/C14H18N4O5/c19-11-8-23-14(13(21)12(11)20)22-6-5-18-7-10(16-17-18)9-3-1-2-4-15-9/h1-4,7,11-14,19-21H,5-6,8H2/t11-,12+,13-,14-/m1/s1 |
| InChIKey | UZLGRIJZIZHBCL-XJFOESAGSA-N |
| XLogP | -1.20 |
| TPSA | 122.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.32 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |