C16H21N3O6 — CID 102169491
(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[2-(4-phenyltriazol-1-yl)ethoxy]oxane-3,4,5-triol (PubChem CID 102169491) has the molecular formula C16H21N3O6 and a molecular weight of 351.36 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[2-(4-phenyltriazol-1-yl)ethoxy]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[2-(4-phenyltriazol-1-yl)ethoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 102169491 |
| Molecular Formula | C16H21N3O6 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[2-(4-phenyltriazol-1-yl)ethoxy]oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](OCCn2cc(-c3ccccc3)nn2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C16H21N3O6/c20-9-12-13(21)14(22)15(23)16(25-12)24-7-6-19-8-11(17-18-19)10-4-2-1-3-5-10/h1-5,8,12-16,20-23H,6-7,9H2/t12-,13-,14+,15-,16-/m1/s1 |
| InChIKey | BHIGDCBKJYMYCQ-IBEHDNSVSA-N |
| XLogP | -1.24 |
| TPSA | 130.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |