C11H19N3O6 — CID 56838624
(2R,3R,4R,5R,6R)-2-(hydroxymethyl)-6-[1-(2-methoxyethyl)triazol-4-yl]oxane-3,4,5-triol (PubChem CID 56838624) has the molecular formula C11H19N3O6 and a molecular weight of 289.29 g/mol. Its IUPAC name is (2R,3R,4R,5R,6R)-2-(hydroxymethyl)-6-[1-(2-methoxyethyl)triazol-4-yl]oxane-3,4,5-triol.
| Compound Name | (2R,3R,4R,5R,6R)-2-(hydroxymethyl)-6-[1-(2-methoxyethyl)triazol-4-yl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 56838624 |
| Molecular Formula | C11H19N3O6 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | (2R,3R,4R,5R,6R)-2-(hydroxymethyl)-6-[1-(2-methoxyethyl)triazol-4-yl]oxane-3,4,5-triol |
| SMILES | COCCn1cc([C@H]2O[C@H](CO)[C@H](O)[C@H](O)[C@H]2O)nn1 |
| InChI | InChI=1S/C11H19N3O6/c1-19-3-2-14-4-6(12-13-14)11-10(18)9(17)8(16)7(5-15)20-11/h4,7-11,15-18H,2-3,5H2,1H3/t7-,8+,9+,10-,11-/m1/s1 |
| InChIKey | MUINVDCRABIJFF-ZKKRXERASA-N |
| XLogP | -2.56 |
| TPSA | 130.09 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | -2.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |