C13H17N5O8 — CID 53483731
methyl 1-[[5-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-1,3,4-oxadiazol-2-yl]methyl]triazole-4-carboxylate (PubChem CID 53483731) has the molecular formula C13H17N5O8 and a molecular weight of 371.31 g/mol. Its IUPAC name is methyl 1-[[5-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-1,3,4-oxadiazol-2-yl]methyl]triazole-4-carboxylate.
| Compound Name | methyl 1-[[5-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-1,3,4-oxadiazol-2-yl]methyl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 53483731 |
| Molecular Formula | C13H17N5O8 |
| Molecular Weight | 371.31 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | methyl 1-[[5-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]-1,3,4-oxadiazol-2-yl]methyl]triazole-4-carboxylate |
| SMILES | COC(=O)c1cn(Cc2nnc([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)o2)nn1 |
| InChI | InChI=1S/C13H17N5O8/c1-24-13(23)5-2-18(17-14-5)3-7-15-16-12(26-7)11-10(22)9(21)8(20)6(4-19)25-11/h2,6,8-11,19-22H,3-4H2,1H3/t6-,8-,9+,10-,11-/m1/s1 |
| InChIKey | HTZVRZSSWAHATL-WVTGURRWSA-N |
| XLogP | -2.99 |
| TPSA | 186.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.31 |
| LogP ≤ 5 | -2.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |