C9H12N3NaO7 — CID 46232679
sodium 1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]triazole-4-carboxylate (PubChem CID 46232679) has the molecular formula C9H12N3NaO7 and a molecular weight of 297.20 g/mol. Its IUPAC name is sodium 1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]triazole-4-carboxylate.
| Compound Name | sodium 1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 46232679 |
| Molecular Formula | C9H12N3NaO7 |
| Molecular Weight | 297.20 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | sodium 1-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]triazole-4-carboxylate |
| SMILES | O=C([O-])c1cn([C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)nn1.[Na+] |
| InChI | InChI=1S/C9H13N3O7.Na/c13-2-4-5(14)6(15)7(16)8(19-4)12-1-3(9(17)18)10-11-12;/h1,4-8,13-16H,2H2,(H,17,18);/q;+1/p-1/t4-,5-,6+,7-,8-;/m1./s1 |
| InChIKey | WQVGKBBAKWHDDH-ALZNSTKSSA-M |
| XLogP | -7.38 |
| TPSA | 160.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.20 |
| LogP ≤ 5 | -7.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |