C14H17N3O8 — CID 136960658
(3S,5S,6R)-2-(hydroxymethyl)-6-[4-(3,4,5-trihydroxyphenyl)triazol-1-yl]oxane-3,4,5-triol (PubChem CID 136960658) has the molecular formula C14H17N3O8 and a molecular weight of 355.30 g/mol. Its IUPAC name is (3S,5S,6R)-2-(hydroxymethyl)-6-[4-(3,4,5-trihydroxyphenyl)triazol-1-yl]oxane-3,4,5-triol.
| Compound Name | (3S,5S,6R)-2-(hydroxymethyl)-6-[4-(3,4,5-trihydroxyphenyl)triazol-1-yl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 136960658 |
| Molecular Formula | C14H17N3O8 |
| Molecular Weight | 355.30 g/mol |
| Exact Mass | 355.10 |
| IUPAC Name | (3S,5S,6R)-2-(hydroxymethyl)-6-[4-(3,4,5-trihydroxyphenyl)triazol-1-yl]oxane-3,4,5-triol |
| SMILES | OCC1O[C@@H](n2cc(-c3cc(O)c(O)c(O)c3)nn2)[C@@H](O)C(O)[C@@H]1O |
| InChI | InChI=1S/C14H17N3O8/c18-4-9-11(22)12(23)13(24)14(25-9)17-3-6(15-16-17)5-1-7(19)10(21)8(20)2-5/h1-3,9,11-14,18-24H,4H2/t9?,11-,12?,13+,14-/m1/s1 |
| InChIKey | GYGQUUXNGMRWTR-TZHDYLEFSA-N |
| XLogP | -1.97 |
| TPSA | 181.55 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.30 |
| LogP ≤ 5 | -1.97 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|