C9H12N3O7- — CID 91934062
1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]triazole-4-carboxylate (PubChem CID 91934062) has the molecular formula C9H12N3O7- and a molecular weight of 274.21 g/mol. Its IUPAC name is 1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]triazole-4-carboxylate.
| Compound Name | 1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]triazole-4-carboxylate |
|---|---|
| PubChem CID | 91934062 |
| Molecular Formula | C9H12N3O7- |
| Molecular Weight | 274.21 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | 1-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]triazole-4-carboxylate |
| SMILES | O=C([O-])c1cn([C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)nn1 |
| InChI | InChI=1S/C9H13N3O7/c13-2-4-5(14)6(15)7(16)8(19-4)12-1-3(9(17)18)10-11-12/h1,4-8,13-16H,2H2,(H,17,18)/p-1/t4-,5-,6+,7-,8+/m1/s1 |
| InChIKey | WGXYXACQLAIHOY-CBQIKETKSA-M |
| XLogP | -4.39 |
| TPSA | 160.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.21 |
| LogP ≤ 5 | -4.39 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |