C13H16N4O5 — CID 46885335
(2R,3R,4S,5R,6R)-2-(hydroxymethyl)-6-(4-pyridin-2-yltriazol-1-yl)oxane-3,4,5-triol (PubChem CID 46885335) has the molecular formula C13H16N4O5 and a molecular weight of 308.29 g/mol. Its IUPAC name is (2R,3R,4S,5R,6R)-2-(hydroxymethyl)-6-(4-pyridin-2-yltriazol-1-yl)oxane-3,4,5-triol.
| Compound Name | (2R,3R,4S,5R,6R)-2-(hydroxymethyl)-6-(4-pyridin-2-yltriazol-1-yl)oxane-3,4,5-triol |
|---|---|
| PubChem CID | 46885335 |
| Molecular Formula | C13H16N4O5 |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.11 |
| IUPAC Name | (2R,3R,4S,5R,6R)-2-(hydroxymethyl)-6-(4-pyridin-2-yltriazol-1-yl)oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](n2cc(-c3ccccn3)nn2)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C13H16N4O5/c18-6-9-10(19)11(20)12(21)13(22-9)17-5-8(15-16-17)7-3-1-2-4-14-7/h1-5,9-13,18-21H,6H2/t9-,10+,11+,12-,13-/m1/s1 |
| InChIKey | IOCRYXOTSAXESZ-KSSYENDESA-N |
| XLogP | -1.69 |
| TPSA | 133.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | -1.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |