C17H23N3O5 — CID 138520938
(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[4-(3-phenylpropyl)triazol-1-yl]oxane-3,4,5-triol (PubChem CID 138520938) has the molecular formula C17H23N3O5 and a molecular weight of 349.39 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[4-(3-phenylpropyl)triazol-1-yl]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[4-(3-phenylpropyl)triazol-1-yl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 138520938 |
| Molecular Formula | C17H23N3O5 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[4-(3-phenylpropyl)triazol-1-yl]oxane-3,4,5-triol |
| SMILES | OC[C@H]1O[C@@H](n2cc(CCCc3ccccc3)nn2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H23N3O5/c21-10-13-14(22)15(23)16(24)17(25-13)20-9-12(18-19-20)8-4-7-11-5-2-1-3-6-11/h1-3,5-6,9,13-17,21-24H,4,7-8,10H2/t13-,14-,15+,16-,17-/m1/s1 |
| InChIKey | JKPUDBOXJGAAHF-NQNKBUKLSA-N |
| XLogP | -0.57 |
| TPSA | 120.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |