C10H16ClN3O4 — CID 25098765
(2R,3R,4S,5R)-2-[4-(3-chloropropyl)triazol-1-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 25098765) has the molecular formula C10H16ClN3O4 and a molecular weight of 277.71 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-[4-(3-chloropropyl)triazol-1-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-[4-(3-chloropropyl)triazol-1-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 25098765 |
| Molecular Formula | C10H16ClN3O4 |
| Molecular Weight | 277.71 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | (2R,3R,4S,5R)-2-[4-(3-chloropropyl)triazol-1-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | OC[C@H]1O[C@@H](n2cc(CCCCl)nn2)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C10H16ClN3O4/c11-3-1-2-6-4-14(13-12-6)10-9(17)8(16)7(5-15)18-10/h4,7-10,15-17H,1-3,5H2/t7-,8-,9-,10-/m1/s1 |
| InChIKey | GISRGAXHDDXORH-ZYUZMQFOSA-N |
| XLogP | -0.94 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.71 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|