C13H23N3O4 — CID 44590142
(2R,3S,4S,5R)-2-(4-hexyltriazol-1-yl)-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 44590142) has the molecular formula C13H23N3O4 and a molecular weight of 285.34 g/mol. Its IUPAC name is (2R,3S,4S,5R)-2-(4-hexyltriazol-1-yl)-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3S,4S,5R)-2-(4-hexyltriazol-1-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 44590142 |
| Molecular Formula | C13H23N3O4 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | (2R,3S,4S,5R)-2-(4-hexyltriazol-1-yl)-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | CCCCCCc1cn([C@@H]2O[C@H](CO)[C@@H](O)[C@@H]2O)nn1 |
| InChI | InChI=1S/C13H23N3O4/c1-2-3-4-5-6-9-7-16(15-14-9)13-12(19)11(18)10(8-17)20-13/h7,10-13,17-19H,2-6,8H2,1H3/t10-,11-,12+,13-/m1/s1 |
| InChIKey | QKRFTZIHSDIQTE-FVCCEPFGSA-N |
| XLogP | 0.01 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|